C45H79O13P — CID 134743908
[(2R)-1-[(E)-hexadec-7-enoyl]oxy-3-[hydroxy-[(5S)-2,3,4,5,6-pentahydroxycyclohexyl]oxyphosphoryl]oxypropan-2-yl] (5E,8E,11E)-icosa-5,8,11-trienoate (PubChem CID 134743908) has the molecular formula C45H79O13P and a molecular weight of 859.09 g/mol. Its IUPAC name is [(2R)-1-[(E)-hexadec-7-enoyl]oxy-3-[hydroxy-[(5S)-2,3,4,5,6-pentahydroxycyclohexyl]oxyphosphoryl]oxypropan-2-yl] (5E,8E,11E)-icosa-5,8,11-trienoate.
| Compound Name | [(2R)-1-[(E)-hexadec-7-enoyl]oxy-3-[hydroxy-[(5S)-2,3,4,5,6-pentahydroxycyclohexyl]oxyphosphoryl]oxypropan-2-yl] (5E,8E,11E)-icosa-5,8,11-trienoate |
|---|---|
| PubChem CID | 134743908 |
| Molecular Formula | C45H79O13P |
| Molecular Weight | 859.09 g/mol |
| Exact Mass | 858.53 |
| IUPAC Name | [(2R)-1-[(E)-hexadec-7-enoyl]oxy-3-[hydroxy-[(5S)-2,3,4,5,6-pentahydroxycyclohexyl]oxyphosphoryl]oxypropan-2-yl] (5E,8E,11E)-icosa-5,8,11-trienoate |
| SMILES | CCCCCCCC/C=C/C/C=C/C/C=C/CCCC(=O)O[C@H](COC(=O)CCCCC/C=C/CCCCCCCC)COP(=O)(O)OC1C(O)C(O)C(O)[C@H](O)C1O |
| InChI | InChI=1S/C45H79O13P/c1-3-5-7-9-11-13-15-17-18-19-20-22-24-26-28-30-32-34-39(47)57-37(36-56-59(53,54)58-45-43(51)41(49)40(48)42(50)44(45)52)35-55-38(46)33-31-29-27-25-23-21-16-14-12-10-8-6-4-2/h17-18,20-23,26,28,37,40-45,48-52H,3-16,19,24-25,27,29-36H2,1-2H3,(H,53,54)/b18-17+,22-20+,23-21+,28-26+/t37-,40?,41+,42?,43?,44?,45?/m1/s1 |
| InChIKey | KIVWKRXGWYNRKE-UYWUZZIASA-N |
| XLogP | 8.39 |
| TPSA | 209.51 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 59 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 859.09 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|