C49H85O13P — CID 162822442
[(2R)-1-[hydroxy-[(5R)-2,3,4,5,6-pentahydroxycyclohexyl]oxyphosphoryl]oxy-3-icosa-5,8,11,14-tetraenoyloxypropan-2-yl] icos-11-enoate (PubChem CID 162822442) has the molecular formula C49H85O13P and a molecular weight of 913.18 g/mol. Its IUPAC name is [(2R)-1-[hydroxy-[(5R)-2,3,4,5,6-pentahydroxycyclohexyl]oxyphosphoryl]oxy-3-icosa-5,8,11,14-tetraenoyloxypropan-2-yl] icos-11-enoate.
| Compound Name | [(2R)-1-[hydroxy-[(5R)-2,3,4,5,6-pentahydroxycyclohexyl]oxyphosphoryl]oxy-3-icosa-5,8,11,14-tetraenoyloxypropan-2-yl] icos-11-enoate |
|---|---|
| PubChem CID | 162822442 |
| Molecular Formula | C49H85O13P |
| Molecular Weight | 913.18 g/mol |
| Exact Mass | 912.57 |
| IUPAC Name | [(2R)-1-[hydroxy-[(5R)-2,3,4,5,6-pentahydroxycyclohexyl]oxyphosphoryl]oxy-3-icosa-5,8,11,14-tetraenoyloxypropan-2-yl] icos-11-enoate |
| SMILES | CCCCCC=CCC=CCC=CCC=CCCCC(=O)OC[C@H](COP(=O)(O)OC1C(O)C(O)C(O)[C@@H](O)C1O)OC(=O)CCCCCCCCCC=CCCCCCCCC |
| InChI | InChI=1S/C49H85O13P/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-42(50)59-39-41(40-60-63(57,58)62-49-47(55)45(53)44(52)46(54)48(49)56)61-43(51)38-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h11,13,17-20,23,25,29,31,41,44-49,52-56H,3-10,12,14-16,21-22,24,26-28,30,32-40H2,1-2H3,(H,57,58)/t41-,44?,45-,46?,47?,48?,49?/m1/s1 |
| InChIKey | RTWKIHCPJYUXKC-AMNHAAHPSA-N |
| XLogP | 9.73 |
| TPSA | 209.51 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 63 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 913.18 |
| LogP ≤ 5 | 9.73 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|