C47H81O13P — CID 134756621
[(2S)-3-[hydroxy-[(5S)-2,3,4,5,6-pentahydroxycyclohexyl]oxyphosphoryl]oxy-2-[(E)-octadec-7-enoyl]oxypropyl] (5E,8E,11E,14E)-icosa-5,8,11,14-tetraenoate (PubChem CID 134756621) has the molecular formula C47H81O13P and a molecular weight of 885.13 g/mol. Its IUPAC name is [(2S)-3-[hydroxy-[(5S)-2,3,4,5,6-pentahydroxycyclohexyl]oxyphosphoryl]oxy-2-[(E)-octadec-7-enoyl]oxypropyl] (5E,8E,11E,14E)-icosa-5,8,11,14-tetraenoate.
| Compound Name | [(2S)-3-[hydroxy-[(5S)-2,3,4,5,6-pentahydroxycyclohexyl]oxyphosphoryl]oxy-2-[(E)-octadec-7-enoyl]oxypropyl] (5E,8E,11E,14E)-icosa-5,8,11,14-tetraenoate |
|---|---|
| PubChem CID | 134756621 |
| Molecular Formula | C47H81O13P |
| Molecular Weight | 885.13 g/mol |
| Exact Mass | 884.54 |
| IUPAC Name | [(2S)-3-[hydroxy-[(5S)-2,3,4,5,6-pentahydroxycyclohexyl]oxyphosphoryl]oxy-2-[(E)-octadec-7-enoyl]oxypropyl] (5E,8E,11E,14E)-icosa-5,8,11,14-tetraenoate |
| SMILES | CCCCC/C=C/C/C=C/C/C=C/C/C=C/CCCC(=O)OC[C@@H](COP(=O)(O)OC1C(O)C(O)C(O)[C@H](O)C1O)OC(=O)CCCCC/C=C/CCCCCCCCCC |
| InChI | InChI=1S/C47H81O13P/c1-3-5-7-9-11-13-15-17-19-20-22-23-25-27-29-31-33-35-40(48)57-37-39(38-58-61(55,56)60-47-45(53)43(51)42(50)44(52)46(47)54)59-41(49)36-34-32-30-28-26-24-21-18-16-14-12-10-8-6-4-2/h11,13,17,19,22-24,26-27,29,39,42-47,50-54H,3-10,12,14-16,18,20-21,25,28,30-38H2,1-2H3,(H,55,56)/b13-11+,19-17+,23-22+,26-24+,29-27+/t39-,42?,43-,44?,45?,46?,47?/m0/s1 |
| InChIKey | OVNDYNFYHFCNSF-GMBZZTBJSA-N |
| XLogP | 8.94 |
| TPSA | 209.51 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 61 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 885.13 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|