C38H67O8P — CID 134744161
[(2R)-2-[(9E,12E)-heptadeca-9,12-dienoyl]oxy-3-phosphonooxypropyl] (6E,9E)-octadeca-6,9-dienoate (PubChem CID 134744161) has the molecular formula C38H67O8P and a molecular weight of 682.92 g/mol. Its IUPAC name is [(2R)-2-[(9E,12E)-heptadeca-9,12-dienoyl]oxy-3-phosphonooxypropyl] (6E,9E)-octadeca-6,9-dienoate.
| Compound Name | [(2R)-2-[(9E,12E)-heptadeca-9,12-dienoyl]oxy-3-phosphonooxypropyl] (6E,9E)-octadeca-6,9-dienoate |
|---|---|
| PubChem CID | 134744161 |
| Molecular Formula | C38H67O8P |
| Molecular Weight | 682.92 g/mol |
| Exact Mass | 682.46 |
| IUPAC Name | [(2R)-2-[(9E,12E)-heptadeca-9,12-dienoyl]oxy-3-phosphonooxypropyl] (6E,9E)-octadeca-6,9-dienoate |
| SMILES | CCCC/C=C/C/C=C/CCCCCCCC(=O)O[C@H](COC(=O)CCCC/C=C/C/C=C/CCCCCCCC)COP(=O)(O)O |
| InChI | InChI=1S/C38H67O8P/c1-3-5-7-9-11-13-15-17-19-21-22-24-26-28-30-32-37(39)44-34-36(35-45-47(41,42)43)46-38(40)33-31-29-27-25-23-20-18-16-14-12-10-8-6-4-2/h10,12,16-19,22,24,36H,3-9,11,13-15,20-21,23,25-35H2,1-2H3,(H2,41,42,43)/b12-10+,18-16+,19-17+,24-22+/t36-/m1/s1 |
| InChIKey | KKSAXDCEIPIOQM-QBZVCCSZSA-N |
| XLogP | 10.79 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.92 |
| LogP ≤ 5 | 10.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|