C36H65O8P — CID 134751537
[(2R)-2-[(E)-hexadec-7-enoyl]oxy-3-phosphonooxypropyl] (9E,12E)-heptadeca-9,12-dienoate (PubChem CID 134751537) has the molecular formula C36H65O8P and a molecular weight of 656.88 g/mol. Its IUPAC name is [(2R)-2-[(E)-hexadec-7-enoyl]oxy-3-phosphonooxypropyl] (9E,12E)-heptadeca-9,12-dienoate.
| Compound Name | [(2R)-2-[(E)-hexadec-7-enoyl]oxy-3-phosphonooxypropyl] (9E,12E)-heptadeca-9,12-dienoate |
|---|---|
| PubChem CID | 134751537 |
| Molecular Formula | C36H65O8P |
| Molecular Weight | 656.88 g/mol |
| Exact Mass | 656.44 |
| IUPAC Name | [(2R)-2-[(E)-hexadec-7-enoyl]oxy-3-phosphonooxypropyl] (9E,12E)-heptadeca-9,12-dienoate |
| SMILES | CCCC/C=C/C/C=C/CCCCCCCC(=O)OC[C@H](COP(=O)(O)O)OC(=O)CCCCC/C=C/CCCCCCCC |
| InChI | InChI=1S/C36H65O8P/c1-3-5-7-9-11-13-15-17-19-20-22-24-26-28-30-35(37)42-32-34(33-43-45(39,40)41)44-36(38)31-29-27-25-23-21-18-16-14-12-10-8-6-4-2/h9,11,15,17-18,21,34H,3-8,10,12-14,16,19-20,22-33H2,1-2H3,(H2,39,40,41)/b11-9+,17-15+,21-18+/t34-/m1/s1 |
| InChIKey | NAMCXWWFGRLZTG-MQVCPVSNSA-N |
| XLogP | 10.23 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.88 |
| LogP ≤ 5 | 10.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|