C26H47O8P — CID 138145194
(1-hexanoyloxy-3-phosphonooxypropan-2-yl) (9Z,12Z)-heptadeca-9,12-dienoate (PubChem CID 138145194) has the molecular formula C26H47O8P and a molecular weight of 518.63 g/mol. Its IUPAC name is (1-hexanoyloxy-3-phosphonooxypropan-2-yl) (9Z,12Z)-heptadeca-9,12-dienoate.
| Compound Name | (1-hexanoyloxy-3-phosphonooxypropan-2-yl) (9Z,12Z)-heptadeca-9,12-dienoate |
|---|---|
| PubChem CID | 138145194 |
| Molecular Formula | C26H47O8P |
| Molecular Weight | 518.63 g/mol |
| Exact Mass | 518.30 |
| IUPAC Name | (1-hexanoyloxy-3-phosphonooxypropan-2-yl) (9Z,12Z)-heptadeca-9,12-dienoate |
| SMILES | CCCC/C=C\C/C=C\CCCCCCCC(=O)OC(COC(=O)CCCCC)COP(=O)(O)O |
| InChI | InChI=1S/C26H47O8P/c1-3-5-7-8-9-10-11-12-13-14-15-16-17-19-21-26(28)34-24(23-33-35(29,30)31)22-32-25(27)20-18-6-4-2/h8-9,11-12,24H,3-7,10,13-23H2,1-2H3,(H2,29,30,31)/b9-8-,12-11- |
| InChIKey | DMZGJPKNGHUQMY-MURFETPASA-N |
| XLogP | 6.55 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.63 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|