C52H85NO7 — CID 134749259
4-[3-[(8E,11E,14E)-heptadeca-8,11,14-trienoyl]oxy-2-[(10E,13E,16E,19E,22E)-pentacosa-10,13,16,19,22-pentaenoyl]oxypropoxy]-2-(trimethylazaniumyl)butanoate (PubChem CID 134749259) has the molecular formula C52H85NO7 and a molecular weight of 836.25 g/mol. Its IUPAC name is 4-[3-[(8E,11E,14E)-heptadeca-8,11,14-trienoyl]oxy-2-[(10E,13E,16E,19E,22E)-pentacosa-10,13,16,19,22-pentaenoyl]oxypropoxy]-2-(trimethylazaniumyl)butanoate.
| Compound Name | 4-[3-[(8E,11E,14E)-heptadeca-8,11,14-trienoyl]oxy-2-[(10E,13E,16E,19E,22E)-pentacosa-10,13,16,19,22-pentaenoyl]oxypropoxy]-2-(trimethylazaniumyl)butanoate |
|---|---|
| PubChem CID | 134749259 |
| Molecular Formula | C52H85NO7 |
| Molecular Weight | 836.25 g/mol |
| Exact Mass | 835.63 |
| IUPAC Name | 4-[3-[(8E,11E,14E)-heptadeca-8,11,14-trienoyl]oxy-2-[(10E,13E,16E,19E,22E)-pentacosa-10,13,16,19,22-pentaenoyl]oxypropoxy]-2-(trimethylazaniumyl)butanoate |
| SMILES | CC/C=C/C/C=C/C/C=C/C/C=C/C/C=C/CCCCCCCCC(=O)OC(COCCC(C(=O)[O-])[N+](C)(C)C)COC(=O)CCCCCC/C=C/C/C=C/C/C=C/CC |
| InChI | InChI=1S/C52H85NO7/c1-6-8-10-12-14-16-18-20-22-23-24-25-26-27-28-29-31-33-35-37-39-41-43-51(55)60-48(46-58-45-44-49(52(56)57)53(3,4)5)47-59-50(54)42-40-38-36-34-32-30-21-19-17-15-13-11-9-7-2/h8-11,14-17,20-22,24-25,27-28,30,48-49H,6-7,12-13,18-19,23,26,29,31-47H2,1-5H3/b10-8+,11-9+,16-14+,17-15+,22-20+,25-24+,28-27+,30-21+ |
| InChIKey | MFKKCRGHOWTZIU-SFTLUABKSA-N |
| XLogP | 11.74 |
| TPSA | 101.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 836.25 |
| LogP ≤ 5 | 11.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|