C39H64O5 — CID 134750918
[(2S)-1-[(E)-hexadec-9-enoyl]oxy-3-hydroxypropan-2-yl] (5E,8E,11E,14E,17E)-icosa-5,8,11,14,17-pentaenoate (PubChem CID 134750918) has the molecular formula C39H64O5 and a molecular weight of 612.94 g/mol. Its IUPAC name is [(2S)-1-[(E)-hexadec-9-enoyl]oxy-3-hydroxypropan-2-yl] (5E,8E,11E,14E,17E)-icosa-5,8,11,14,17-pentaenoate.
| Compound Name | [(2S)-1-[(E)-hexadec-9-enoyl]oxy-3-hydroxypropan-2-yl] (5E,8E,11E,14E,17E)-icosa-5,8,11,14,17-pentaenoate |
|---|---|
| PubChem CID | 134750918 |
| Molecular Formula | C39H64O5 |
| Molecular Weight | 612.94 g/mol |
| Exact Mass | 612.48 |
| IUPAC Name | [(2S)-1-[(E)-hexadec-9-enoyl]oxy-3-hydroxypropan-2-yl] (5E,8E,11E,14E,17E)-icosa-5,8,11,14,17-pentaenoate |
| SMILES | CC/C=C/C/C=C/C/C=C/C/C=C/C/C=C/CCCC(=O)O[C@@H](CO)COC(=O)CCCCCCC/C=C/CCCCCC |
| InChI | InChI=1S/C39H64O5/c1-3-5-7-9-11-13-15-17-18-19-20-22-24-26-28-30-32-34-39(42)44-37(35-40)36-43-38(41)33-31-29-27-25-23-21-16-14-12-10-8-6-4-2/h5,7,11,13-14,16-18,20,22,26,28,37,40H,3-4,6,8-10,12,15,19,21,23-25,27,29-36H2,1-2H3/b7-5+,13-11+,16-14+,18-17+,22-20+,28-26+/t37-/m0/s1 |
| InChIKey | MUYDIVLBRBWUDW-WGXRILFZSA-N |
| XLogP | 10.61 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.94 |
| LogP ≤ 5 | 10.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|