C44H76O10 — CID 134752809
[(2R)-1-[(E)-heptadec-9-enoyl]oxy-3-[(2S,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl] (6E,9E,12E)-octadeca-6,9,12-trienoate (PubChem CID 134752809) has the molecular formula C44H76O10 and a molecular weight of 765.08 g/mol. Its IUPAC name is [(2R)-1-[(E)-heptadec-9-enoyl]oxy-3-[(2S,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl] (6E,9E,12E)-octadeca-6,9,12-trienoate.
| Compound Name | [(2R)-1-[(E)-heptadec-9-enoyl]oxy-3-[(2S,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl] (6E,9E,12E)-octadeca-6,9,12-trienoate |
|---|---|
| PubChem CID | 134752809 |
| Molecular Formula | C44H76O10 |
| Molecular Weight | 765.08 g/mol |
| Exact Mass | 764.54 |
| IUPAC Name | [(2R)-1-[(E)-heptadec-9-enoyl]oxy-3-[(2S,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl] (6E,9E,12E)-octadeca-6,9,12-trienoate |
| SMILES | CCCCC/C=C/C/C=C/C/C=C/CCCCC(=O)O[C@@H](COC(=O)CCCCCCC/C=C/CCCCCCC)CO[C@H]1O[C@@H](CO)[C@@H](O)C(O)C1O |
| InChI | InChI=1S/C44H76O10/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-40(47)53-37(36-52-44-43(50)42(49)41(48)38(34-45)54-44)35-51-39(46)32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h11,13,16-19,23,25,37-38,41-45,48-50H,3-10,12,14-15,20-22,24,26-36H2,1-2H3/b13-11+,18-16+,19-17+,25-23+/t37-,38-,41+,42?,43?,44-/m0/s1 |
| InChIKey | NMCOHDJMNFONAS-DECNCNFGSA-N |
| XLogP | 8.49 |
| TPSA | 151.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.08 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|