C13H9NO3 — CID 13475600
5-(pyridin-3-ylmethyl)-1,3-benzodioxol-2-one (PubChem CID 13475600) has the molecular formula C13H9NO3 and a molecular weight of 227.22 g/mol. Its IUPAC name is 5-(pyridin-3-ylmethyl)-1,3-benzodioxol-2-one.
| Compound Name | 5-(pyridin-3-ylmethyl)-1,3-benzodioxol-2-one |
|---|---|
| PubChem CID | 13475600 |
| Molecular Formula | C13H9NO3 |
| Molecular Weight | 227.22 g/mol |
| Exact Mass | 227.06 |
| IUPAC Name | 5-(pyridin-3-ylmethyl)-1,3-benzodioxol-2-one |
| SMILES | O=c1oc2ccc(Cc3cccnc3)cc2o1 |
| InChI | InChI=1S/C13H9NO3/c15-13-16-11-4-3-9(7-12(11)17-13)6-10-2-1-5-14-8-10/h1-5,7-8H,6H2 |
| InChIKey | HHMKQLONJVJYDC-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 56.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.22 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |