C45H74O10 — CID 134756301
[(2R)-2-[(6E,9E,12E,15E)-octadeca-6,9,12,15-tetraenoyl]oxy-3-[(2S,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl] (6E,9E)-octadeca-6,9-dienoate (PubChem CID 134756301) has the molecular formula C45H74O10 and a molecular weight of 775.08 g/mol. Its IUPAC name is [(2R)-2-[(6E,9E,12E,15E)-octadeca-6,9,12,15-tetraenoyl]oxy-3-[(2S,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl] (6E,9E)-octadeca-6,9-dienoate.
| Compound Name | [(2R)-2-[(6E,9E,12E,15E)-octadeca-6,9,12,15-tetraenoyl]oxy-3-[(2S,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl] (6E,9E)-octadeca-6,9-dienoate |
|---|---|
| PubChem CID | 134756301 |
| Molecular Formula | C45H74O10 |
| Molecular Weight | 775.08 g/mol |
| Exact Mass | 774.53 |
| IUPAC Name | [(2R)-2-[(6E,9E,12E,15E)-octadeca-6,9,12,15-tetraenoyl]oxy-3-[(2S,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl] (6E,9E)-octadeca-6,9-dienoate |
| SMILES | CC/C=C/C/C=C/C/C=C/C/C=C/CCCCC(=O)O[C@@H](COC(=O)CCCC/C=C/C/C=C/CCCCCCCC)CO[C@H]1O[C@@H](CO)[C@@H](O)C(O)C1O |
| InChI | InChI=1S/C45H74O10/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-40(47)52-36-38(37-53-45-44(51)43(50)42(49)39(35-46)55-45)54-41(48)34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h6,8,12,14,17-20,23-26,38-39,42-46,49-51H,3-5,7,9-11,13,15-16,21-22,27-37H2,1-2H3/b8-6+,14-12+,19-17+,20-18+,25-23+,26-24+/t38-,39-,42+,43?,44?,45-/m0/s1 |
| InChIKey | OSPRCIDTZUDAFL-NYMJRHQSSA-N |
| XLogP | 8.44 |
| TPSA | 151.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 775.08 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|