C37H60O10 — CID 134761773
[1-[(3E,6E,9E)-dodeca-3,6,9-trienoyl]oxy-3-[(2R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl] (4E,7E)-hexadeca-4,7-dienoate (PubChem CID 134761773) has the molecular formula C37H60O10 and a molecular weight of 664.88 g/mol. Its IUPAC name is [1-[(3E,6E,9E)-dodeca-3,6,9-trienoyl]oxy-3-[(2R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl] (4E,7E)-hexadeca-4,7-dienoate.
| Compound Name | [1-[(3E,6E,9E)-dodeca-3,6,9-trienoyl]oxy-3-[(2R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl] (4E,7E)-hexadeca-4,7-dienoate |
|---|---|
| PubChem CID | 134761773 |
| Molecular Formula | C37H60O10 |
| Molecular Weight | 664.88 g/mol |
| Exact Mass | 664.42 |
| IUPAC Name | [1-[(3E,6E,9E)-dodeca-3,6,9-trienoyl]oxy-3-[(2R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl] (4E,7E)-hexadeca-4,7-dienoate |
| SMILES | CC/C=C/C/C=C/C/C=C/CC(=O)OCC(CO[C@@H]1O[C@H](CO)[C@H](O)C(O)C1O)OC(=O)CC/C=C/C/C=C/CCCCCCCC |
| InChI | InChI=1S/C37H60O10/c1-3-5-7-9-11-13-14-15-16-18-20-22-24-26-33(40)46-30(29-45-37-36(43)35(42)34(41)31(27-38)47-37)28-44-32(39)25-23-21-19-17-12-10-8-6-4-2/h6,8,12,15-17,20-23,30-31,34-38,41-43H,3-5,7,9-11,13-14,18-19,24-29H2,1-2H3/b8-6+,16-15+,17-12+,22-20+,23-21+/t30?,31-,34+,35?,36?,37-/m1/s1 |
| InChIKey | QPOXVKOGVNEUOS-GMLXRCRCSA-N |
| XLogP | 5.54 |
| TPSA | 151.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.88 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|