C40H66O10 — CID 134785472
[1-[(6E,9E,12E)-pentadeca-6,9,12-trienoyl]oxy-3-[(2R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl] (4E,7E)-hexadeca-4,7-dienoate (PubChem CID 134785472) has the molecular formula C40H66O10 and a molecular weight of 706.96 g/mol. Its IUPAC name is [1-[(6E,9E,12E)-pentadeca-6,9,12-trienoyl]oxy-3-[(2R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl] (4E,7E)-hexadeca-4,7-dienoate.
| Compound Name | [1-[(6E,9E,12E)-pentadeca-6,9,12-trienoyl]oxy-3-[(2R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl] (4E,7E)-hexadeca-4,7-dienoate |
|---|---|
| PubChem CID | 134785472 |
| Molecular Formula | C40H66O10 |
| Molecular Weight | 706.96 g/mol |
| Exact Mass | 706.47 |
| IUPAC Name | [1-[(6E,9E,12E)-pentadeca-6,9,12-trienoyl]oxy-3-[(2R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl] (4E,7E)-hexadeca-4,7-dienoate |
| SMILES | CC/C=C/C/C=C/C/C=C/CCCCC(=O)OCC(CO[C@@H]1O[C@H](CO)[C@H](O)C(O)C1O)OC(=O)CC/C=C/C/C=C/CCCCCCCC |
| InChI | InChI=1S/C40H66O10/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-36(43)49-33(32-48-40-39(46)38(45)37(44)34(30-41)50-40)31-47-35(42)28-26-24-22-20-18-16-14-12-10-8-6-4-2/h6,8,12,14,17-20,23,25,33-34,37-41,44-46H,3-5,7,9-11,13,15-16,21-22,24,26-32H2,1-2H3/b8-6+,14-12+,19-17+,20-18+,25-23+/t33?,34-,37+,38?,39?,40-/m1/s1 |
| InChIKey | ZTMBWXYDDTVZEB-UAWXVMCTSA-N |
| XLogP | 6.71 |
| TPSA | 151.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.96 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|