C51H88O10 — CID 134766252
[(2S)-1-[(E)-icos-11-enoyl]oxy-3-[(2R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl] (7E,10E,13E,16E)-docosa-7,10,13,16-tetraenoate (PubChem CID 134766252) has the molecular formula C51H88O10 and a molecular weight of 861.25 g/mol. Its IUPAC name is [(2S)-1-[(E)-icos-11-enoyl]oxy-3-[(2R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl] (7E,10E,13E,16E)-docosa-7,10,13,16-tetraenoate.
| Compound Name | [(2S)-1-[(E)-icos-11-enoyl]oxy-3-[(2R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl] (7E,10E,13E,16E)-docosa-7,10,13,16-tetraenoate |
|---|---|
| PubChem CID | 134766252 |
| Molecular Formula | C51H88O10 |
| Molecular Weight | 861.25 g/mol |
| Exact Mass | 860.64 |
| IUPAC Name | [(2S)-1-[(E)-icos-11-enoyl]oxy-3-[(2R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl] (7E,10E,13E,16E)-docosa-7,10,13,16-tetraenoate |
| SMILES | CCCCC/C=C/C/C=C/C/C=C/C/C=C/CCCCCC(=O)O[C@H](COC(=O)CCCCCCCCC/C=C/CCCCCCCC)CO[C@@H]1O[C@H](CO)[C@H](O)C(O)C1O |
| InChI | InChI=1S/C51H88O10/c1-3-5-7-9-11-13-15-17-19-21-22-24-26-28-30-32-34-36-38-40-47(54)60-44(43-59-51-50(57)49(56)48(55)45(41-52)61-51)42-58-46(53)39-37-35-33-31-29-27-25-23-20-18-16-14-12-10-8-6-4-2/h11,13,17-20,22,24,28,30,44-45,48-52,55-57H,3-10,12,14-16,21,23,25-27,29,31-43H2,1-2H3/b13-11+,19-17+,20-18+,24-22+,30-28+/t44-,45-,48+,49?,50?,51-/m1/s1 |
| InChIKey | SDZBDZCKGXRACV-INJJYAKUSA-N |
| XLogP | 11.00 |
| TPSA | 151.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 861.25 |
| LogP ≤ 5 | 11.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|