C47H81O13P — CID 134766465
[(2R)-1-[hydroxy-[(5S)-2,3,4,5,6-pentahydroxycyclohexyl]oxyphosphoryl]oxy-3-[(9E,11E)-octadeca-9,11-dienoyl]oxypropan-2-yl] (5E,8E,11E)-icosa-5,8,11-trienoate (PubChem CID 134766465) has the molecular formula C47H81O13P and a molecular weight of 885.13 g/mol. Its IUPAC name is [(2R)-1-[hydroxy-[(5S)-2,3,4,5,6-pentahydroxycyclohexyl]oxyphosphoryl]oxy-3-[(9E,11E)-octadeca-9,11-dienoyl]oxypropan-2-yl] (5E,8E,11E)-icosa-5,8,11-trienoate.
| Compound Name | [(2R)-1-[hydroxy-[(5S)-2,3,4,5,6-pentahydroxycyclohexyl]oxyphosphoryl]oxy-3-[(9E,11E)-octadeca-9,11-dienoyl]oxypropan-2-yl] (5E,8E,11E)-icosa-5,8,11-trienoate |
|---|---|
| PubChem CID | 134766465 |
| Molecular Formula | C47H81O13P |
| Molecular Weight | 885.13 g/mol |
| Exact Mass | 884.54 |
| IUPAC Name | [(2R)-1-[hydroxy-[(5S)-2,3,4,5,6-pentahydroxycyclohexyl]oxyphosphoryl]oxy-3-[(9E,11E)-octadeca-9,11-dienoyl]oxypropan-2-yl] (5E,8E,11E)-icosa-5,8,11-trienoate |
| SMILES | CCCCCC/C=C/C=C/CCCCCCCC(=O)OC[C@H](COP(=O)(O)OC1C(O)C(O)C(O)[C@H](O)C1O)OC(=O)CCC/C=C/C/C=C/C/C=C/CCCCCCCC |
| InChI | InChI=1S/C47H81O13P/c1-3-5-7-9-11-13-15-17-19-20-22-24-26-28-30-32-34-36-41(49)59-39(38-58-61(55,56)60-47-45(53)43(51)42(50)44(52)46(47)54)37-57-40(48)35-33-31-29-27-25-23-21-18-16-14-12-10-8-6-4-2/h14,16-19,21-22,24,28,30,39,42-47,50-54H,3-13,15,20,23,25-27,29,31-38H2,1-2H3,(H,55,56)/b16-14+,19-17+,21-18+,24-22+,30-28+/t39-,42?,43+,44?,45?,46?,47?/m1/s1 |
| InChIKey | SGAJHFIWPYRJST-GBWMPHRPSA-N |
| XLogP | 8.94 |
| TPSA | 209.51 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 61 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 885.13 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|