C24H31NO5 — CID 13477620
methyl 3-[3-[(4-hexyl-3-methoxyphenoxy)methyl]anilino]-3-oxopropanoate (PubChem CID 13477620) has the molecular formula C24H31NO5 and a molecular weight of 413.51 g/mol. Its IUPAC name is methyl 3-[3-[(4-hexyl-3-methoxyphenoxy)methyl]anilino]-3-oxopropanoate.
| Compound Name | methyl 3-[3-[(4-hexyl-3-methoxyphenoxy)methyl]anilino]-3-oxopropanoate |
|---|---|
| PubChem CID | 13477620 |
| Molecular Formula | C24H31NO5 |
| Molecular Weight | 413.51 g/mol |
| Exact Mass | 413.22 |
| IUPAC Name | methyl 3-[3-[(4-hexyl-3-methoxyphenoxy)methyl]anilino]-3-oxopropanoate |
| SMILES | CCCCCCc1ccc(OCc2cccc(NC(=O)CC(=O)OC)c2)cc1OC |
| InChI | InChI=1S/C24H31NO5/c1-4-5-6-7-10-19-12-13-21(15-22(19)28-2)30-17-18-9-8-11-20(14-18)25-23(26)16-24(27)29-3/h8-9,11-15H,4-7,10,16-17H2,1-3H3,(H,25,26) |
| InChIKey | KCPILQQRESVBSN-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.51 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|