C24H43NO6 — CID 134780847
4-[2-hydroxy-3-[(7E,9E)-tetradeca-7,9-dienoyl]oxypropoxy]-2-(trimethylazaniumyl)butanoate (PubChem CID 134780847) has the molecular formula C24H43NO6 and a molecular weight of 441.61 g/mol. Its IUPAC name is 4-[2-hydroxy-3-[(7E,9E)-tetradeca-7,9-dienoyl]oxypropoxy]-2-(trimethylazaniumyl)butanoate.
| Compound Name | 4-[2-hydroxy-3-[(7E,9E)-tetradeca-7,9-dienoyl]oxypropoxy]-2-(trimethylazaniumyl)butanoate |
|---|---|
| PubChem CID | 134780847 |
| Molecular Formula | C24H43NO6 |
| Molecular Weight | 441.61 g/mol |
| Exact Mass | 441.31 |
| IUPAC Name | 4-[2-hydroxy-3-[(7E,9E)-tetradeca-7,9-dienoyl]oxypropoxy]-2-(trimethylazaniumyl)butanoate |
| SMILES | CCCC/C=C/C=C/CCCCCC(=O)OCC(O)COCCC(C(=O)[O-])[N+](C)(C)C |
| InChI | InChI=1S/C24H43NO6/c1-5-6-7-8-9-10-11-12-13-14-15-16-23(27)31-20-21(26)19-30-18-17-22(24(28)29)25(2,3)4/h8-11,21-22,26H,5-7,12-20H2,1-4H3/b9-8+,11-10+ |
| InChIKey | YDLNHHNUNPVGIA-BNFZFUHLSA-N |
| XLogP | 2.38 |
| TPSA | 95.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.61 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|