C29H55NO6 — CID 134762467
4-[2-hydroxy-3-[(E)-nonadec-9-enoyl]oxypropoxy]-2-(trimethylazaniumyl)butanoate (PubChem CID 134762467) has the molecular formula C29H55NO6 and a molecular weight of 513.76 g/mol. Its IUPAC name is 4-[2-hydroxy-3-[(E)-nonadec-9-enoyl]oxypropoxy]-2-(trimethylazaniumyl)butanoate.
| Compound Name | 4-[2-hydroxy-3-[(E)-nonadec-9-enoyl]oxypropoxy]-2-(trimethylazaniumyl)butanoate |
|---|---|
| PubChem CID | 134762467 |
| Molecular Formula | C29H55NO6 |
| Molecular Weight | 513.76 g/mol |
| Exact Mass | 513.40 |
| IUPAC Name | 4-[2-hydroxy-3-[(E)-nonadec-9-enoyl]oxypropoxy]-2-(trimethylazaniumyl)butanoate |
| SMILES | CCCCCCCCC/C=C/CCCCCCCC(=O)OCC(O)COCCC(C(=O)[O-])[N+](C)(C)C |
| InChI | InChI=1S/C29H55NO6/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-28(32)36-25-26(31)24-35-23-22-27(29(33)34)30(2,3)4/h13-14,26-27,31H,5-12,15-25H2,1-4H3/b14-13+ |
| InChIKey | QVZUWWZJEPBDTI-BUHFOSPRSA-N |
| XLogP | 4.55 |
| TPSA | 95.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.76 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|