C26H50NO6+ — CID 138175540
[1-carboxy-3-[3-[(Z)-hexadec-9-enoyl]oxy-2-hydroxypropoxy]propyl]-trimethylazanium (PubChem CID 138175540) has the molecular formula C26H50NO6+ and a molecular weight of 472.69 g/mol. Its IUPAC name is [1-carboxy-3-[3-[(Z)-hexadec-9-enoyl]oxy-2-hydroxypropoxy]propyl]-trimethylazanium.
| Compound Name | [1-carboxy-3-[3-[(Z)-hexadec-9-enoyl]oxy-2-hydroxypropoxy]propyl]-trimethylazanium |
|---|---|
| PubChem CID | 138175540 |
| Molecular Formula | C26H50NO6+ |
| Molecular Weight | 472.69 g/mol |
| Exact Mass | 472.36 |
| IUPAC Name | [1-carboxy-3-[3-[(Z)-hexadec-9-enoyl]oxy-2-hydroxypropoxy]propyl]-trimethylazanium |
| SMILES | CCCCCC/C=C\CCCCCCCC(=O)OCC(O)COCCC(C(=O)O)[N+](C)(C)C |
| InChI | InChI=1S/C26H49NO6/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-25(29)33-22-23(28)21-32-20-19-24(26(30)31)27(2,3)4/h10-11,23-24,28H,5-9,12-22H2,1-4H3/p+1/b11-10- |
| InChIKey | IDIZIPFHKJZRPB-KHPPLWFESA-O |
| XLogP | 4.71 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.69 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|