C34H60NO6+ — CID 134719034
[1-carboxy-3-[2-hydroxy-3-[(9E,12E,15E,18E)-tetracosa-9,12,15,18-tetraenoyl]oxypropoxy]propyl]-trimethylazanium (PubChem CID 134719034) has the molecular formula C34H60NO6+ and a molecular weight of 578.86 g/mol. Its IUPAC name is [1-carboxy-3-[2-hydroxy-3-[(9E,12E,15E,18E)-tetracosa-9,12,15,18-tetraenoyl]oxypropoxy]propyl]-trimethylazanium.
| Compound Name | [1-carboxy-3-[2-hydroxy-3-[(9E,12E,15E,18E)-tetracosa-9,12,15,18-tetraenoyl]oxypropoxy]propyl]-trimethylazanium |
|---|---|
| PubChem CID | 134719034 |
| Molecular Formula | C34H60NO6+ |
| Molecular Weight | 578.86 g/mol |
| Exact Mass | 578.44 |
| IUPAC Name | [1-carboxy-3-[2-hydroxy-3-[(9E,12E,15E,18E)-tetracosa-9,12,15,18-tetraenoyl]oxypropoxy]propyl]-trimethylazanium |
| SMILES | CCCCC/C=C/C/C=C/C/C=C/C/C=C/CCCCCCCC(=O)OCC(O)COCCC(C(=O)O)[N+](C)(C)C |
| InChI | InChI=1S/C34H59NO6/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-26-33(37)41-30-31(36)29-40-28-27-32(34(38)39)35(2,3)4/h9-10,12-13,15-16,18-19,31-32,36H,5-8,11,14,17,20-30H2,1-4H3/p+1/b10-9+,13-12+,16-15+,19-18+ |
| InChIKey | APNXJGZWNLMQDV-WFYBHXQRSA-O |
| XLogP | 7.16 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.86 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|