C40H74NO7+ — CID 134762588
[1-carboxy-3-[2-decanoyloxy-3-[(11E,14E)-icosa-11,14-dienoyl]oxypropoxy]propyl]-trimethylazanium (PubChem CID 134762588) has the molecular formula C40H74NO7+ and a molecular weight of 681.03 g/mol. Its IUPAC name is [1-carboxy-3-[2-decanoyloxy-3-[(11E,14E)-icosa-11,14-dienoyl]oxypropoxy]propyl]-trimethylazanium.
| Compound Name | [1-carboxy-3-[2-decanoyloxy-3-[(11E,14E)-icosa-11,14-dienoyl]oxypropoxy]propyl]-trimethylazanium |
|---|---|
| PubChem CID | 134762588 |
| Molecular Formula | C40H74NO7+ |
| Molecular Weight | 681.03 g/mol |
| Exact Mass | 680.55 |
| IUPAC Name | [1-carboxy-3-[2-decanoyloxy-3-[(11E,14E)-icosa-11,14-dienoyl]oxypropoxy]propyl]-trimethylazanium |
| SMILES | CCCCC/C=C/C/C=C/CCCCCCCCCC(=O)OCC(COCCC(C(=O)O)[N+](C)(C)C)OC(=O)CCCCCCCCC |
| InChI | InChI=1S/C40H73NO7/c1-6-8-10-12-14-15-16-17-18-19-20-21-22-23-25-26-28-30-38(42)47-35-36(34-46-33-32-37(40(44)45)41(3,4)5)48-39(43)31-29-27-24-13-11-9-7-2/h14-15,17-18,36-37H,6-13,16,19-35H2,1-5H3/p+1/b15-14+,18-17+ |
| InChIKey | QWYLTTCLLJEDBR-QYWXAPKASA-O |
| XLogP | 9.74 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.03 |
| LogP ≤ 5 | 9.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|