C49H84NO7+ — CID 134717639
[1-carboxy-3-[3-[(E)-pentadec-9-enoyl]oxy-2-[(6E,9E,12E,15E,18E)-tetracosa-6,9,12,15,18-pentaenoyl]oxypropoxy]propyl]-trimethylazanium (PubChem CID 134717639) has the molecular formula C49H84NO7+ and a molecular weight of 799.21 g/mol. Its IUPAC name is [1-carboxy-3-[3-[(E)-pentadec-9-enoyl]oxy-2-[(6E,9E,12E,15E,18E)-tetracosa-6,9,12,15,18-pentaenoyl]oxypropoxy]propyl]-trimethylazanium.
| Compound Name | [1-carboxy-3-[3-[(E)-pentadec-9-enoyl]oxy-2-[(6E,9E,12E,15E,18E)-tetracosa-6,9,12,15,18-pentaenoyl]oxypropoxy]propyl]-trimethylazanium |
|---|---|
| PubChem CID | 134717639 |
| Molecular Formula | C49H84NO7+ |
| Molecular Weight | 799.21 g/mol |
| Exact Mass | 798.62 |
| IUPAC Name | [1-carboxy-3-[3-[(E)-pentadec-9-enoyl]oxy-2-[(6E,9E,12E,15E,18E)-tetracosa-6,9,12,15,18-pentaenoyl]oxypropoxy]propyl]-trimethylazanium |
| SMILES | CCCCC/C=C/C/C=C/C/C=C/C/C=C/C/C=C/CCCCC(=O)OC(COCCC(C(=O)O)[N+](C)(C)C)COC(=O)CCCCCCC/C=C/CCCCC |
| InChI | InChI=1S/C49H83NO7/c1-6-8-10-12-14-16-18-20-21-22-23-24-25-26-27-28-30-32-34-36-38-40-48(52)57-45(43-55-42-41-46(49(53)54)50(3,4)5)44-56-47(51)39-37-35-33-31-29-19-17-15-13-11-9-7-2/h14-17,20-21,23-24,26-27,30,32,45-46H,6-13,18-19,22,25,28-29,31,33-44H2,1-5H3/p+1/b16-14+,17-15+,21-20+,24-23+,27-26+,32-30+ |
| InChIKey | ACMLNSUFZMDJSL-NJNVANCDSA-O |
| XLogP | 12.36 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 799.21 |
| LogP ≤ 5 | 12.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|