C38H68NO7+ — CID 138132549
[1-carboxy-3-[2-[(10Z,13Z,16Z)-docosa-10,13,16-trienoyl]oxy-3-hexanoyloxypropoxy]propyl]-trimethylazanium (PubChem CID 138132549) has the molecular formula C38H68NO7+ and a molecular weight of 650.96 g/mol. Its IUPAC name is [1-carboxy-3-[2-[(10Z,13Z,16Z)-docosa-10,13,16-trienoyl]oxy-3-hexanoyloxypropoxy]propyl]-trimethylazanium.
| Compound Name | [1-carboxy-3-[2-[(10Z,13Z,16Z)-docosa-10,13,16-trienoyl]oxy-3-hexanoyloxypropoxy]propyl]-trimethylazanium |
|---|---|
| PubChem CID | 138132549 |
| Molecular Formula | C38H68NO7+ |
| Molecular Weight | 650.96 g/mol |
| Exact Mass | 650.50 |
| IUPAC Name | [1-carboxy-3-[2-[(10Z,13Z,16Z)-docosa-10,13,16-trienoyl]oxy-3-hexanoyloxypropoxy]propyl]-trimethylazanium |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\CCCCCCCCC(=O)OC(COCCC(C(=O)O)[N+](C)(C)C)COC(=O)CCCCC |
| InChI | InChI=1S/C38H67NO7/c1-6-8-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-27-29-37(41)46-34(33-45-36(40)28-26-9-7-2)32-44-31-30-35(38(42)43)39(3,4)5/h12-13,15-16,18-19,34-35H,6-11,14,17,20-33H2,1-5H3/p+1/b13-12-,16-15-,19-18- |
| InChIKey | CACOHUJUORHKFN-LJURNQLPSA-O |
| XLogP | 8.74 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.96 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|