C41H76NO7+ — CID 138119511
[1-carboxy-3-[2-[(11Z,14Z)-icosa-11,14-dienoyl]oxy-3-undecanoyloxypropoxy]propyl]-trimethylazanium (PubChem CID 138119511) has the molecular formula C41H76NO7+ and a molecular weight of 695.06 g/mol. Its IUPAC name is [1-carboxy-3-[2-[(11Z,14Z)-icosa-11,14-dienoyl]oxy-3-undecanoyloxypropoxy]propyl]-trimethylazanium.
| Compound Name | [1-carboxy-3-[2-[(11Z,14Z)-icosa-11,14-dienoyl]oxy-3-undecanoyloxypropoxy]propyl]-trimethylazanium |
|---|---|
| PubChem CID | 138119511 |
| Molecular Formula | C41H76NO7+ |
| Molecular Weight | 695.06 g/mol |
| Exact Mass | 694.56 |
| IUPAC Name | [1-carboxy-3-[2-[(11Z,14Z)-icosa-11,14-dienoyl]oxy-3-undecanoyloxypropoxy]propyl]-trimethylazanium |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCCC(=O)OC(COCCC(C(=O)O)[N+](C)(C)C)COC(=O)CCCCCCCCCC |
| InChI | InChI=1S/C41H75NO7/c1-6-8-10-12-14-16-17-18-19-20-21-22-23-24-26-28-30-32-40(44)49-37(35-47-34-33-38(41(45)46)42(3,4)5)36-48-39(43)31-29-27-25-15-13-11-9-7-2/h14,16,18-19,37-38H,6-13,15,17,20-36H2,1-5H3/p+1/b16-14-,19-18- |
| InChIKey | ALNFABKHKGRTNJ-JHHNDBJRSA-O |
| XLogP | 10.13 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.06 |
| LogP ≤ 5 | 10.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|