C28H54NO6+ — CID 138155638
[1-carboxy-3-[2-hydroxy-3-[(Z)-octadec-9-enoyl]oxypropoxy]propyl]-trimethylazanium (PubChem CID 138155638) has the molecular formula C28H54NO6+ and a molecular weight of 500.74 g/mol. Its IUPAC name is [1-carboxy-3-[2-hydroxy-3-[(Z)-octadec-9-enoyl]oxypropoxy]propyl]-trimethylazanium.
| Compound Name | [1-carboxy-3-[2-hydroxy-3-[(Z)-octadec-9-enoyl]oxypropoxy]propyl]-trimethylazanium |
|---|---|
| PubChem CID | 138155638 |
| Molecular Formula | C28H54NO6+ |
| Molecular Weight | 500.74 g/mol |
| Exact Mass | 500.39 |
| IUPAC Name | [1-carboxy-3-[2-hydroxy-3-[(Z)-octadec-9-enoyl]oxypropoxy]propyl]-trimethylazanium |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OCC(O)COCCC(C(=O)O)[N+](C)(C)C |
| InChI | InChI=1S/C28H53NO6/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-27(31)35-24-25(30)23-34-22-21-26(28(32)33)29(2,3)4/h12-13,25-26,30H,5-11,14-24H2,1-4H3/p+1/b13-12- |
| InChIKey | FTLDFSGPEPRILR-SEYXRHQNSA-O |
| XLogP | 5.49 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.74 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|