C36H62NO6+ — CID 134726383
[1-carboxy-3-[3-[(11E,14E,17E,20E,23E)-hexacosa-11,14,17,20,23-pentaenoyl]oxy-2-hydroxypropoxy]propyl]-trimethylazanium (PubChem CID 134726383) has the molecular formula C36H62NO6+ and a molecular weight of 604.89 g/mol. Its IUPAC name is [1-carboxy-3-[3-[(11E,14E,17E,20E,23E)-hexacosa-11,14,17,20,23-pentaenoyl]oxy-2-hydroxypropoxy]propyl]-trimethylazanium.
| Compound Name | [1-carboxy-3-[3-[(11E,14E,17E,20E,23E)-hexacosa-11,14,17,20,23-pentaenoyl]oxy-2-hydroxypropoxy]propyl]-trimethylazanium |
|---|---|
| PubChem CID | 134726383 |
| Molecular Formula | C36H62NO6+ |
| Molecular Weight | 604.89 g/mol |
| Exact Mass | 604.46 |
| IUPAC Name | [1-carboxy-3-[3-[(11E,14E,17E,20E,23E)-hexacosa-11,14,17,20,23-pentaenoyl]oxy-2-hydroxypropoxy]propyl]-trimethylazanium |
| SMILES | CC/C=C/C/C=C/C/C=C/C/C=C/C/C=C/CCCCCCCCCC(=O)OCC(O)COCCC(C(=O)O)[N+](C)(C)C |
| InChI | InChI=1S/C36H61NO6/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-26-27-28-35(39)43-32-33(38)31-42-30-29-34(36(40)41)37(2,3)4/h6-7,9-10,12-13,15-16,18-19,33-34,38H,5,8,11,14,17,20-32H2,1-4H3/p+1/b7-6+,10-9+,13-12+,16-15+,19-18+ |
| InChIKey | DEIWNHUOIYJIOB-GUTOPQIJSA-O |
| XLogP | 7.72 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.89 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|