C32H55NO6 — CID 138259018
4-[3-[(10Z,13Z,16Z,19Z)-docosa-10,13,16,19-tetraenoyl]oxy-2-hydroxypropoxy]-2-(trimethylazaniumyl)butanoate (PubChem CID 138259018) has the molecular formula C32H55NO6 and a molecular weight of 549.79 g/mol. Its IUPAC name is 4-[3-[(10Z,13Z,16Z,19Z)-docosa-10,13,16,19-tetraenoyl]oxy-2-hydroxypropoxy]-2-(trimethylazaniumyl)butanoate.
| Compound Name | 4-[3-[(10Z,13Z,16Z,19Z)-docosa-10,13,16,19-tetraenoyl]oxy-2-hydroxypropoxy]-2-(trimethylazaniumyl)butanoate |
|---|---|
| PubChem CID | 138259018 |
| Molecular Formula | C32H55NO6 |
| Molecular Weight | 549.79 g/mol |
| Exact Mass | 549.40 |
| IUPAC Name | 4-[3-[(10Z,13Z,16Z,19Z)-docosa-10,13,16,19-tetraenoyl]oxy-2-hydroxypropoxy]-2-(trimethylazaniumyl)butanoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\CCCCCCCCC(=O)OCC(O)COCCC(C(=O)[O-])[N+](C)(C)C |
| InChI | InChI=1S/C32H55NO6/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-31(35)39-28-29(34)27-38-26-25-30(32(36)37)33(2,3)4/h6-7,9-10,12-13,15-16,29-30,34H,5,8,11,14,17-28H2,1-4H3/b7-6-,10-9-,13-12-,16-15- |
| InChIKey | SCGJFBYWZKPBIF-DOFZRALJSA-N |
| XLogP | 5.05 |
| TPSA | 95.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.79 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|