C35H59NO6 — CID 134719720
4-[2-hydroxy-3-[(10E,13E,16E,19E,22E)-pentacosa-10,13,16,19,22-pentaenoyl]oxypropoxy]-2-(trimethylazaniumyl)butanoate (PubChem CID 134719720) has the molecular formula C35H59NO6 and a molecular weight of 589.86 g/mol. Its IUPAC name is 4-[2-hydroxy-3-[(10E,13E,16E,19E,22E)-pentacosa-10,13,16,19,22-pentaenoyl]oxypropoxy]-2-(trimethylazaniumyl)butanoate.
| Compound Name | 4-[2-hydroxy-3-[(10E,13E,16E,19E,22E)-pentacosa-10,13,16,19,22-pentaenoyl]oxypropoxy]-2-(trimethylazaniumyl)butanoate |
|---|---|
| PubChem CID | 134719720 |
| Molecular Formula | C35H59NO6 |
| Molecular Weight | 589.86 g/mol |
| Exact Mass | 589.43 |
| IUPAC Name | 4-[2-hydroxy-3-[(10E,13E,16E,19E,22E)-pentacosa-10,13,16,19,22-pentaenoyl]oxypropoxy]-2-(trimethylazaniumyl)butanoate |
| SMILES | CC/C=C/C/C=C/C/C=C/C/C=C/C/C=C/CCCCCCCCC(=O)OCC(O)COCCC(C(=O)[O-])[N+](C)(C)C |
| InChI | InChI=1S/C35H59NO6/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-26-27-34(38)42-31-32(37)30-41-29-28-33(35(39)40)36(2,3)4/h6-7,9-10,12-13,15-16,18-19,32-33,37H,5,8,11,14,17,20-31H2,1-4H3/b7-6+,10-9+,13-12+,16-15+,19-18+ |
| InChIKey | AVYALNACNSXGQG-GUTOPQIJSA-N |
| XLogP | 5.99 |
| TPSA | 95.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.86 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|