C39H66NO7+ — CID 134730941
[1-carboxy-3-[3-[(6E,9E)-dodeca-6,9-dienoyl]oxy-2-[(8E,11E,14E)-heptadeca-8,11,14-trienoyl]oxypropoxy]propyl]-trimethylazanium (PubChem CID 134730941) has the molecular formula C39H66NO7+ and a molecular weight of 660.96 g/mol. Its IUPAC name is [1-carboxy-3-[3-[(6E,9E)-dodeca-6,9-dienoyl]oxy-2-[(8E,11E,14E)-heptadeca-8,11,14-trienoyl]oxypropoxy]propyl]-trimethylazanium.
| Compound Name | [1-carboxy-3-[3-[(6E,9E)-dodeca-6,9-dienoyl]oxy-2-[(8E,11E,14E)-heptadeca-8,11,14-trienoyl]oxypropoxy]propyl]-trimethylazanium |
|---|---|
| PubChem CID | 134730941 |
| Molecular Formula | C39H66NO7+ |
| Molecular Weight | 660.96 g/mol |
| Exact Mass | 660.48 |
| IUPAC Name | [1-carboxy-3-[3-[(6E,9E)-dodeca-6,9-dienoyl]oxy-2-[(8E,11E,14E)-heptadeca-8,11,14-trienoyl]oxypropoxy]propyl]-trimethylazanium |
| SMILES | CC/C=C/C/C=C/C/C=C/CCCCCCC(=O)OC(COCCC(C(=O)O)[N+](C)(C)C)COC(=O)CCCC/C=C/C/C=C/CC |
| InChI | InChI=1S/C39H65NO7/c1-6-8-10-12-14-16-17-18-19-20-22-24-26-28-30-38(42)47-35(33-45-32-31-36(39(43)44)40(3,4)5)34-46-37(41)29-27-25-23-21-15-13-11-9-7-2/h8-11,14-16,18-19,21,35-36H,6-7,12-13,17,20,22-34H2,1-5H3/p+1/b10-8+,11-9+,16-14+,19-18+,21-15+ |
| InChIKey | FUVZRPMMZZXLCV-KUXFOONMSA-O |
| XLogP | 8.68 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.96 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|