C40H74NO8P — CID 134784672
[(2R)-1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(E)-pentadec-9-enoyl]oxypropan-2-yl] (11E,14E)-icosa-11,14-dienoate (PubChem CID 134784672) has the molecular formula C40H74NO8P and a molecular weight of 728.00 g/mol. Its IUPAC name is [(2R)-1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(E)-pentadec-9-enoyl]oxypropan-2-yl] (11E,14E)-icosa-11,14-dienoate.
| Compound Name | [(2R)-1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(E)-pentadec-9-enoyl]oxypropan-2-yl] (11E,14E)-icosa-11,14-dienoate |
|---|---|
| PubChem CID | 134784672 |
| Molecular Formula | C40H74NO8P |
| Molecular Weight | 728.00 g/mol |
| Exact Mass | 727.52 |
| IUPAC Name | [(2R)-1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(E)-pentadec-9-enoyl]oxypropan-2-yl] (11E,14E)-icosa-11,14-dienoate |
| SMILES | CCCCC/C=C/C/C=C/CCCCCCCCCC(=O)O[C@H](COC(=O)CCCCCCC/C=C/CCCCC)COP(=O)(O)OCCN |
| InChI | InChI=1S/C40H74NO8P/c1-3-5-7-9-11-13-15-17-18-19-20-21-23-25-27-29-31-33-40(43)49-38(37-48-50(44,45)47-35-34-41)36-46-39(42)32-30-28-26-24-22-16-14-12-10-8-6-4-2/h11-14,17-18,38H,3-10,15-16,19-37,41H2,1-2H3,(H,44,45)/b13-11+,14-12+,18-17+/t38-/m1/s1 |
| InChIKey | ZMHRRYPGEPQAHC-NZYCSONQSA-N |
| XLogP | 10.99 |
| TPSA | 134.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.00 |
| LogP ≤ 5 | 10.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|