C15H21N3O2S — CID 134787257
CID 134787257 (PubChem CID 134787257) has the molecular formula C15H21N3O2S and a molecular weight of 307.42 g/mol.
| Compound Name | CID 134787257 |
|---|---|
| PubChem CID | 134787257 |
| Molecular Formula | C15H21N3O2S |
| Molecular Weight | 307.42 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | — |
| SMILES | O=[S+]([O-])(C1CC1)N1C2CCC1CN(Cc1cccnc1)C2 |
| InChI | InChI=1S/C15H21N3O2S/c19-21(20,15-5-6-15)18-13-3-4-14(18)11-17(10-13)9-12-2-1-7-16-8-12/h1-2,7-8,13-15H,3-6,9-11H2 |
| InChIKey | JJAXBICDRAISCE-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.42 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|