C21H21ClF3NO2 — CID 134787709
4-(4-chlorophenyl)-N-methyl-N-[[3-(trifluoromethyl)phenyl]methyl]oxane-4-carboxamide (PubChem CID 134787709) has the molecular formula C21H21ClF3NO2 and a molecular weight of 411.85 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-N-methyl-N-[[3-(trifluoromethyl)phenyl]methyl]oxane-4-carboxamide.
| Compound Name | 4-(4-chlorophenyl)-N-methyl-N-[[3-(trifluoromethyl)phenyl]methyl]oxane-4-carboxamide |
|---|---|
| PubChem CID | 134787709 |
| Molecular Formula | C21H21ClF3NO2 |
| Molecular Weight | 411.85 g/mol |
| Exact Mass | 411.12 |
| IUPAC Name | 4-(4-chlorophenyl)-N-methyl-N-[[3-(trifluoromethyl)phenyl]methyl]oxane-4-carboxamide |
| SMILES | CN(Cc1cccc(C(F)(F)F)c1)C(=O)C1(c2ccc(Cl)cc2)CCOCC1 |
| InChI | InChI=1S/C21H21ClF3NO2/c1-26(14-15-3-2-4-17(13-15)21(23,24)25)19(27)20(9-11-28-12-10-20)16-5-7-18(22)8-6-16/h2-8,13H,9-12,14H2,1H3 |
| InChIKey | RJFRTIRBLHTNFN-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.85 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |