C21H21BrF3NO2 — CID 55997190
N-[(2-bromophenyl)methyl]-N-methyl-4-[3-(trifluoromethyl)phenyl]oxane-4-carboxamide (PubChem CID 55997190) has the molecular formula C21H21BrF3NO2 and a molecular weight of 456.30 g/mol. Its IUPAC name is N-[(2-bromophenyl)methyl]-N-methyl-4-[3-(trifluoromethyl)phenyl]oxane-4-carboxamide.
| Compound Name | N-[(2-bromophenyl)methyl]-N-methyl-4-[3-(trifluoromethyl)phenyl]oxane-4-carboxamide |
|---|---|
| PubChem CID | 55997190 |
| Molecular Formula | C21H21BrF3NO2 |
| Molecular Weight | 456.30 g/mol |
| Exact Mass | 455.07 |
| IUPAC Name | N-[(2-bromophenyl)methyl]-N-methyl-4-[3-(trifluoromethyl)phenyl]oxane-4-carboxamide |
| SMILES | CN(Cc1ccccc1Br)C(=O)C1(c2cccc(C(F)(F)F)c2)CCOCC1 |
| InChI | InChI=1S/C21H21BrF3NO2/c1-26(14-15-5-2-3-8-18(15)22)19(27)20(9-11-28-12-10-20)16-6-4-7-17(13-16)21(23,24)25/h2-8,13H,9-12,14H2,1H3 |
| InChIKey | DNORQEITQCIONI-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.30 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |