C15H24N6O2 — CID 134788532
morpholin-4-yl-[2-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]methanone (PubChem CID 134788532) has the molecular formula C15H24N6O2 and a molecular weight of 320.40 g/mol. Its IUPAC name is morpholin-4-yl-[2-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]methanone.
| Compound Name | morpholin-4-yl-[2-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 134788532 |
| Molecular Formula | C15H24N6O2 |
| Molecular Weight | 320.40 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | morpholin-4-yl-[2-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]methanone |
| SMILES | O=C(N1CCOCC1)N1CCCCC1c1nnc2n1CCNC2 |
| InChI | InChI=1S/C15H24N6O2/c22-15(19-7-9-23-10-8-19)20-5-2-1-3-12(20)14-18-17-13-11-16-4-6-21(13)14/h12,16H,1-11H2 |
| InChIKey | QZVMYXCNDIZZFA-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 75.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.40 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |