C22H28N2O2S — CID 134788656
CID 134788656 (PubChem CID 134788656) has the molecular formula C22H28N2O2S and a molecular weight of 384.55 g/mol.
| Compound Name | CID 134788656 |
|---|---|
| PubChem CID | 134788656 |
| Molecular Formula | C22H28N2O2S |
| Molecular Weight | 384.55 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | — |
| SMILES | CCCN1CCCC12Cc1ccccc1CN([S+](=O)([O-])c1ccccc1)C2 |
| InChI | InChI=1S/C22H28N2O2S/c1-2-14-23-15-8-13-22(23)16-19-9-6-7-10-20(19)17-24(18-22)27(25,26)21-11-4-3-5-12-21/h3-7,9-12H,2,8,13-18H2,1H3 |
| InChIKey | GLDXXQVXBUTVFO-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.55 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|