C21H23ClN2O3S — CID 134789907
CID 134789907 (PubChem CID 134789907) has the molecular formula C21H23ClN2O3S and a molecular weight of 418.95 g/mol.
| Compound Name | CID 134789907 |
|---|---|
| PubChem CID | 134789907 |
| Molecular Formula | C21H23ClN2O3S |
| Molecular Weight | 418.95 g/mol |
| Exact Mass | 418.11 |
| IUPAC Name | — |
| SMILES | C[S+](=O)([O-])N1CCCC2(Cc3ccccc3CN2C(=O)c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C21H23ClN2O3S/c1-28(26,27)23-12-4-11-21(15-23)13-17-5-2-3-6-18(17)14-24(21)20(25)16-7-9-19(22)10-8-16/h2-3,5-10H,4,11-15H2,1H3 |
| InChIKey | XXROFJUOOWFFMJ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.95 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|