C22H34N2O2S — CID 134790084
CID 134790084 (PubChem CID 134790084) has the molecular formula C22H34N2O2S and a molecular weight of 390.59 g/mol.
| Compound Name | CID 134790084 |
|---|---|
| PubChem CID | 134790084 |
| Molecular Formula | C22H34N2O2S |
| Molecular Weight | 390.59 g/mol |
| Exact Mass | 390.23 |
| IUPAC Name | — |
| SMILES | C[S+](=O)([O-])N1Cc2ccccc2CC2(CCN(CC3CCCCC3)CC2)C1 |
| InChI | InChI=1S/C22H34N2O2S/c1-27(25,26)24-17-21-10-6-5-9-20(21)15-22(18-24)11-13-23(14-12-22)16-19-7-3-2-4-8-19/h5-6,9-10,19H,2-4,7-8,11-18H2,1H3 |
| InChIKey | VRNCVYYOTACFPL-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.59 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|