C23H28N2O4S — CID 134791192
CID 134791192 (PubChem CID 134791192) has the molecular formula C23H28N2O4S and a molecular weight of 428.55 g/mol.
| Compound Name | CID 134791192 |
|---|---|
| PubChem CID | 134791192 |
| Molecular Formula | C23H28N2O4S |
| Molecular Weight | 428.55 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | — |
| SMILES | COc1ccc(CC(=O)N2Cc3ccccc3CC23CCCN([S+](C)(=O)[O-])C3)cc1 |
| InChI | InChI=1S/C23H28N2O4S/c1-29-21-10-8-18(9-11-21)14-22(26)25-16-20-7-4-3-6-19(20)15-23(25)12-5-13-24(17-23)30(2,27)28/h3-4,6-11H,5,12-17H2,1-2H3 |
| InChIKey | HZFKQQYRHHQEAT-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.55 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|