C21H26N2O3S — CID 134790562
CID 134790562 (PubChem CID 134790562) has the molecular formula C21H26N2O3S and a molecular weight of 386.52 g/mol.
| Compound Name | CID 134790562 |
|---|---|
| PubChem CID | 134790562 |
| Molecular Formula | C21H26N2O3S |
| Molecular Weight | 386.52 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | — |
| SMILES | COc1ccc(CN2CCCC23Cc2ccccc2N([S+](C)(=O)[O-])C3)cc1 |
| InChI | InChI=1S/C21H26N2O3S/c1-26-19-10-8-17(9-11-19)15-22-13-5-12-21(22)14-18-6-3-4-7-20(18)23(16-21)27(2,24)25/h3-4,6-11H,5,12-16H2,1-2H3 |
| InChIKey | DXUHTZAKFOVRRM-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.52 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|