C14H13N3O3S — CID 134788814
5-(1,3-benzothiazol-2-ylmethyl)-3a,4,6,6a-tetrahydropyrrolo[3,4-d][1,2]oxazole-3-carboxylic acid (PubChem CID 134788814) has the molecular formula C14H13N3O3S and a molecular weight of 303.34 g/mol. Its IUPAC name is 5-(1,3-benzothiazol-2-ylmethyl)-3a,4,6,6a-tetrahydropyrrolo[3,4-d][1,2]oxazole-3-carboxylic acid.
| Compound Name | 5-(1,3-benzothiazol-2-ylmethyl)-3a,4,6,6a-tetrahydropyrrolo[3,4-d][1,2]oxazole-3-carboxylic acid |
|---|---|
| PubChem CID | 134788814 |
| Molecular Formula | C14H13N3O3S |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | 5-(1,3-benzothiazol-2-ylmethyl)-3a,4,6,6a-tetrahydropyrrolo[3,4-d][1,2]oxazole-3-carboxylic acid |
| SMILES | O=C(O)C1=NOC2CN(Cc3nc4ccccc4s3)CC12 |
| InChI | InChI=1S/C14H13N3O3S/c18-14(19)13-8-5-17(6-10(8)20-16-13)7-12-15-9-3-1-2-4-11(9)21-12/h1-4,8,10H,5-7H2,(H,18,19) |
| InChIKey | XJRNSQPBRVOTDO-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 75.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |