C22H27ClN2O2 — CID 134789866
tert-butyl 3-[[4-(4-chloro-2-methylphenyl)phenyl]methylamino]azetidine-1-carboxylate (PubChem CID 134789866) has the molecular formula C22H27ClN2O2 and a molecular weight of 386.92 g/mol. Its IUPAC name is tert-butyl 3-[[4-(4-chloro-2-methylphenyl)phenyl]methylamino]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[4-(4-chloro-2-methylphenyl)phenyl]methylamino]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 134789866 |
| Molecular Formula | C22H27ClN2O2 |
| Molecular Weight | 386.92 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | tert-butyl 3-[[4-(4-chloro-2-methylphenyl)phenyl]methylamino]azetidine-1-carboxylate |
| SMILES | Cc1cc(Cl)ccc1-c1ccc(CNC2CN(C(=O)OC(C)(C)C)C2)cc1 |
| InChI | InChI=1S/C22H27ClN2O2/c1-15-11-18(23)9-10-20(15)17-7-5-16(6-8-17)12-24-19-13-25(14-19)21(26)27-22(2,3)4/h5-11,19,24H,12-14H2,1-4H3 |
| InChIKey | KFABDRDXHRXJOH-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.92 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |