C22H27ClN2O2 — CID 134803408
ethyl N-[1-[[3-(3-chloro-4-methylphenyl)phenyl]methyl]piperidin-3-yl]carbamate (PubChem CID 134803408) has the molecular formula C22H27ClN2O2 and a molecular weight of 386.92 g/mol. Its IUPAC name is ethyl N-[1-[[3-(3-chloro-4-methylphenyl)phenyl]methyl]piperidin-3-yl]carbamate.
| Compound Name | ethyl N-[1-[[3-(3-chloro-4-methylphenyl)phenyl]methyl]piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 134803408 |
| Molecular Formula | C22H27ClN2O2 |
| Molecular Weight | 386.92 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | ethyl N-[1-[[3-(3-chloro-4-methylphenyl)phenyl]methyl]piperidin-3-yl]carbamate |
| SMILES | CCOC(=O)NC1CCCN(Cc2cccc(-c3ccc(C)c(Cl)c3)c2)C1 |
| InChI | InChI=1S/C22H27ClN2O2/c1-3-27-22(26)24-20-8-5-11-25(15-20)14-17-6-4-7-18(12-17)19-10-9-16(2)21(23)13-19/h4,6-7,9-10,12-13,20H,3,5,8,11,14-15H2,1-2H3,(H,24,26) |
| InChIKey | XQUALUNMWUAGJR-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.92 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |