C19H19ClN2O4S — CID 134790967
CID 134790967 (PubChem CID 134790967) has the molecular formula C19H19ClN2O4S and a molecular weight of 406.89 g/mol.
| Compound Name | CID 134790967 |
|---|---|
| PubChem CID | 134790967 |
| Molecular Formula | C19H19ClN2O4S |
| Molecular Weight | 406.89 g/mol |
| Exact Mass | 406.08 |
| IUPAC Name | — |
| SMILES | O=C(c1ccc(Cl)cc1)N1CCC2(CC1)COc1ccccc1[S+](=O)([O-])N2 |
| InChI | InChI=1S/C19H19ClN2O4S/c20-15-7-5-14(6-8-15)18(23)22-11-9-19(10-12-22)13-26-16-3-1-2-4-17(16)27(24,25)21-19/h1-8H,9-13H2,(H-,21,24,25) |
| InChIKey | MNYKLQURPAZQMH-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.89 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|