C19H20F3N3O3S — CID 134791107
CID 134791107 (PubChem CID 134791107) has the molecular formula C19H20F3N3O3S and a molecular weight of 427.45 g/mol.
| Compound Name | CID 134791107 |
|---|---|
| PubChem CID | 134791107 |
| Molecular Formula | C19H20F3N3O3S |
| Molecular Weight | 427.45 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | — |
| SMILES | O=[S+]1([O-])NCC2(CCCN(Cc3ccc(C(F)(F)F)cc3)C2)Oc2ncccc21 |
| InChI | InChI=1S/C19H20F3N3O3S/c20-19(21,22)15-6-4-14(5-7-15)11-25-10-2-8-18(13-25)12-24-29(26,27)16-3-1-9-23-17(16)28-18/h1,3-7,9H,2,8,10-13H2,(H-,24,26,27) |
| InChIKey | LYEKSGFQDYNXLP-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.45 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|