C17H20N4O3S — CID 118740593
1'-(pyridin-2-ylmethyl)spiro[2,3-dihydropyrido[2,3-b][1,4,5]oxathiazepine-4,3'-piperidine] 1,1-dioxide (PubChem CID 118740593) has the molecular formula C17H20N4O3S and a molecular weight of 360.44 g/mol. Its IUPAC name is 1'-(pyridin-2-ylmethyl)spiro[2,3-dihydropyrido[2,3-b][1,4,5]oxathiazepine-4,3'-piperidine] 1,1-dioxide.
| Compound Name | 1'-(pyridin-2-ylmethyl)spiro[2,3-dihydropyrido[2,3-b][1,4,5]oxathiazepine-4,3'-piperidine] 1,1-dioxide |
|---|---|
| PubChem CID | 118740593 |
| Molecular Formula | C17H20N4O3S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | 1'-(pyridin-2-ylmethyl)spiro[2,3-dihydropyrido[2,3-b][1,4,5]oxathiazepine-4,3'-piperidine] 1,1-dioxide |
| SMILES | O=S1(=O)NCC2(CCCN(Cc3ccccn3)C2)Oc2ncccc21 |
| InChI | InChI=1S/C17H20N4O3S/c22-25(23)15-6-3-9-19-16(15)24-17(12-20-25)7-4-10-21(13-17)11-14-5-1-2-8-18-14/h1-3,5-6,8-9,20H,4,7,10-13H2 |
| InChIKey | PPLCZTPTDQFPFK-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |