C15H23N3O3S — CID 118740594
1'-(3-methylbutyl)spiro[2,3-dihydropyrido[2,3-b][1,4,5]oxathiazepine-4,3'-pyrrolidine] 1,1-dioxide (PubChem CID 118740594) has the molecular formula C15H23N3O3S and a molecular weight of 325.43 g/mol. Its IUPAC name is 1'-(3-methylbutyl)spiro[2,3-dihydropyrido[2,3-b][1,4,5]oxathiazepine-4,3'-pyrrolidine] 1,1-dioxide.
| Compound Name | 1'-(3-methylbutyl)spiro[2,3-dihydropyrido[2,3-b][1,4,5]oxathiazepine-4,3'-pyrrolidine] 1,1-dioxide |
|---|---|
| PubChem CID | 118740594 |
| Molecular Formula | C15H23N3O3S |
| Molecular Weight | 325.43 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | 1'-(3-methylbutyl)spiro[2,3-dihydropyrido[2,3-b][1,4,5]oxathiazepine-4,3'-pyrrolidine] 1,1-dioxide |
| SMILES | CC(C)CCN1CCC2(CNS(=O)(=O)c3cccnc3O2)C1 |
| InChI | InChI=1S/C15H23N3O3S/c1-12(2)5-8-18-9-6-15(11-18)10-17-22(19,20)13-4-3-7-16-14(13)21-15/h3-4,7,12,17H,5-6,8-11H2,1-2H3 |
| InChIKey | GCOCYLMWAVPTBP-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.43 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |