C20H24N4O4S — CID 134787489
N-[4-[(1,1-dioxospiro[2,3-dihydropyrido[2,3-b][1,4,5]oxathiazepine-4,3'-piperidine]-1'-yl)methyl]phenyl]acetamide (PubChem CID 134787489) has the molecular formula C20H24N4O4S and a molecular weight of 416.50 g/mol. Its IUPAC name is N-[4-[(1,1-dioxospiro[2,3-dihydropyrido[2,3-b][1,4,5]oxathiazepine-4,3'-piperidine]-1'-yl)methyl]phenyl]acetamide.
| Compound Name | N-[4-[(1,1-dioxospiro[2,3-dihydropyrido[2,3-b][1,4,5]oxathiazepine-4,3'-piperidine]-1'-yl)methyl]phenyl]acetamide |
|---|---|
| PubChem CID | 134787489 |
| Molecular Formula | C20H24N4O4S |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | N-[4-[(1,1-dioxospiro[2,3-dihydropyrido[2,3-b][1,4,5]oxathiazepine-4,3'-piperidine]-1'-yl)methyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(CN2CCCC3(CNS(=O)(=O)c4cccnc4O3)C2)cc1 |
| InChI | InChI=1S/C20H24N4O4S/c1-15(25)23-17-7-5-16(6-8-17)12-24-11-3-9-20(14-24)13-22-29(26,27)18-4-2-10-21-19(18)28-20/h2,4-8,10,22H,3,9,11-14H2,1H3,(H,23,25) |
| InChIKey | VUPIMUGPXDCRHR-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |