C17H16ClN5O2 — CID 134791512
6-chloro-N-[1-([1,3]oxazolo[4,5-b]pyridin-2-yl)piperidin-4-yl]pyridine-3-carboxamide (PubChem CID 134791512) has the molecular formula C17H16ClN5O2 and a molecular weight of 357.80 g/mol. Its IUPAC name is 6-chloro-N-[1-([1,3]oxazolo[4,5-b]pyridin-2-yl)piperidin-4-yl]pyridine-3-carboxamide.
| Compound Name | 6-chloro-N-[1-([1,3]oxazolo[4,5-b]pyridin-2-yl)piperidin-4-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 134791512 |
| Molecular Formula | C17H16ClN5O2 |
| Molecular Weight | 357.80 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | 6-chloro-N-[1-([1,3]oxazolo[4,5-b]pyridin-2-yl)piperidin-4-yl]pyridine-3-carboxamide |
| SMILES | O=C(NC1CCN(c2nc3ncccc3o2)CC1)c1ccc(Cl)nc1 |
| InChI | InChI=1S/C17H16ClN5O2/c18-14-4-3-11(10-20-14)16(24)21-12-5-8-23(9-6-12)17-22-15-13(25-17)2-1-7-19-15/h1-4,7,10,12H,5-6,8-9H2,(H,21,24) |
| InChIKey | DWGLYNXTPOACDC-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 84.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.80 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|