C10H12N4O — CID 43831644
1-([1,3]oxazolo[4,5-b]pyridin-2-yl)pyrrolidin-3-amine (PubChem CID 43831644) has the molecular formula C10H12N4O and a molecular weight of 204.23 g/mol. Its IUPAC name is 1-([1,3]oxazolo[4,5-b]pyridin-2-yl)pyrrolidin-3-amine.
| Compound Name | 1-([1,3]oxazolo[4,5-b]pyridin-2-yl)pyrrolidin-3-amine |
|---|---|
| PubChem CID | 43831644 |
| Molecular Formula | C10H12N4O |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | 1-([1,3]oxazolo[4,5-b]pyridin-2-yl)pyrrolidin-3-amine |
| SMILES | NC1CCN(c2nc3ncccc3o2)C1 |
| InChI | InChI=1S/C10H12N4O/c11-7-3-5-14(6-7)10-13-9-8(15-10)2-1-4-12-9/h1-2,4,7H,3,5-6,11H2 |
| InChIKey | LXCGGKLZKWRYJH-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |