C15H16F3NOS — CID 134793831
N-methyl-1-thiophen-2-yl-N-[[4-(trifluoromethoxy)phenyl]methyl]ethanamine (PubChem CID 134793831) has the molecular formula C15H16F3NOS and a molecular weight of 315.36 g/mol. Its IUPAC name is N-methyl-1-thiophen-2-yl-N-[[4-(trifluoromethoxy)phenyl]methyl]ethanamine.
| Compound Name | N-methyl-1-thiophen-2-yl-N-[[4-(trifluoromethoxy)phenyl]methyl]ethanamine |
|---|---|
| PubChem CID | 134793831 |
| Molecular Formula | C15H16F3NOS |
| Molecular Weight | 315.36 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | N-methyl-1-thiophen-2-yl-N-[[4-(trifluoromethoxy)phenyl]methyl]ethanamine |
| SMILES | CC(c1cccs1)N(C)Cc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C15H16F3NOS/c1-11(14-4-3-9-21-14)19(2)10-12-5-7-13(8-6-12)20-15(16,17)18/h3-9,11H,10H2,1-2H3 |
| InChIKey | PIEFUTUQMVHSEG-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.36 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |